C26H37NO4 — CID 54706843
1,4-dihydroxy-3-[(2R,3R,5R)-3-methyl-5-[(6R)-6-methyloctyl]oxan-2-yl]-5-phenylpyridin-2-one (PubChem CID 54706843) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1,4-dihydroxy-3-[(2R,3R,5R)-3-methyl-5-[(6R)-6-methyloctyl]oxan-2-yl]-5-phenylpyridin-2-one.
| Compound Name | 1,4-dihydroxy-3-[(2R,3R,5R)-3-methyl-5-[(6R)-6-methyloctyl]oxan-2-yl]-5-phenylpyridin-2-one |
|---|---|
| PubChem CID | 54706843 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 1,4-dihydroxy-3-[(2R,3R,5R)-3-methyl-5-[(6R)-6-methyloctyl]oxan-2-yl]-5-phenylpyridin-2-one |
| SMILES | CC[C@@H](C)CCCCC[C@H]1CO[C@@H](c2c(O)c(-c3ccccc3)cn(O)c2=O)[C@H](C)C1 |
| InChI | InChI=1S/C26H37NO4/c1-4-18(2)11-7-5-8-12-20-15-19(3)25(31-17-20)23-24(28)22(16-27(30)26(23)29)21-13-9-6-10-14-21/h6,9-10,13-14,16,18-20,25,28,30H,4-5,7-8,11-12,15,17H2,1-3H3/t18-,19-,20-,25-/m1/s1 |
| InChIKey | ACOSAFDPMSTWSL-KYCQWFEFSA-N |
| XLogP | 6.17 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|