C15H16NO4- — CID 54712594
2-carboxy-5-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenolate (PubChem CID 54712594) has the molecular formula C15H16NO4- and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-carboxy-5-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenolate.
| Compound Name | 2-carboxy-5-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenolate |
|---|---|
| PubChem CID | 54712594 |
| Molecular Formula | C15H16NO4- |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-carboxy-5-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenolate |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccc(C(=O)O)c([O-])c2)C1 |
| InChI | InChI=1S/C15H17NO4/c1-15(2)7-10(5-11(17)8-15)16-9-3-4-12(14(19)20)13(18)6-9/h3-6,16,18H,7-8H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | QWTVPNFWXLCSBL-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |