About N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide
N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54718936) has the molecular formula C17H17N3O4S
and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
Molecular Properties
| Compound Name | N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| PubChem CID | 54718936 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CCn1cccc/c1=N/C(=O)C1=C(O)c2ccccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C17H17N3O4S/c1-3-20-11-7-6-10-14(20)18-17(22)15-16(21)12-8-4-5-9-13(12)25(23,24)19(15)2/h4-11,21H,3H2,1-2H3/b18-14- |
| InChIKey | FZFZTZWTPOYSFG-JXAWBTAJSA-N |
| XLogP | 1.50 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The IUPAC name of N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (CID 54718936) is N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
What is the SMILES notation for N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The canonical SMILES for N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is CCn1cccc/c1=N/C(=O)C1=C(O)c2ccccc2S(=O)(=O)N1C.
What is the InChIKey of N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The InChIKey is FZFZTZWTPOYSFG-JXAWBTAJSA-N. The full InChI is InChI=1S/C17H17N3O4S/c1-3-20-11-7-6-10-14(20)18-17(22)15-16(21)12-8-4-5-9-13(12)25(23,24)19(15)2/h4-11,21H,3H2,1-2H3/b18-14-.
What are the key properties of N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide has a molecular weight of 359.41 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-2-pyridinylidene)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is sourced from PubChem (CID 54718936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).