C26H34O5 — CID 54724861
3-[cyclopropyl(phenyl)methyl]-4-hydroxy-10-[2-(2-methoxyethoxy)ethyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one (PubChem CID 54724861) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 3-[cyclopropyl(phenyl)methyl]-4-hydroxy-10-[2-(2-methoxyethoxy)ethyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one.
| Compound Name | 3-[cyclopropyl(phenyl)methyl]-4-hydroxy-10-[2-(2-methoxyethoxy)ethyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one |
|---|---|
| PubChem CID | 54724861 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 3-[cyclopropyl(phenyl)methyl]-4-hydroxy-10-[2-(2-methoxyethoxy)ethyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one |
| SMILES | COCCOCCC1CCCCCc2c1oc(=O)c(C(c1ccccc1)C1CC1)c2O |
| InChI | InChI=1S/C26H34O5/c1-29-16-17-30-15-14-20-10-6-3-7-11-21-24(27)23(26(28)31-25(20)21)22(19-12-13-19)18-8-4-2-5-9-18/h2,4-5,8-9,19-20,22,27H,3,6-7,10-17H2,1H3 |
| InChIKey | HIAZUHHMARNILR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|