C34H37NO9 — CID 54718718
benzyl N-[3-[cyclopropyl-[4-hydroxy-7-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxochromen-3-yl]methyl]phenyl]carbamate (PubChem CID 54718718) has the molecular formula C34H37NO9 and a molecular weight of 603.67 g/mol. Its IUPAC name is benzyl N-[3-[cyclopropyl-[4-hydroxy-7-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxochromen-3-yl]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[3-[cyclopropyl-[4-hydroxy-7-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxochromen-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 54718718 |
| Molecular Formula | C34H37NO9 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | benzyl N-[3-[cyclopropyl-[4-hydroxy-7-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxochromen-3-yl]methyl]phenyl]carbamate |
| SMILES | COCCOCCOCCOc1ccc2c(O)c(C(c3cccc(NC(=O)OCc4ccccc4)c3)C3CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C34H37NO9/c1-39-14-15-40-16-17-41-18-19-42-27-12-13-28-29(21-27)44-33(37)31(32(28)36)30(24-10-11-24)25-8-5-9-26(20-25)35-34(38)43-22-23-6-3-2-4-7-23/h2-9,12-13,20-21,24,30,36H,10-11,14-19,22H2,1H3,(H,35,38) |
| InChIKey | ZNBYIYBUPFPNRF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|