C19H17N4O6S- — CID 54730999
3-(4-methoxyphenyl)-4-[1-[(4-nitrobenzene-6-id-1-yl)amino]-1-oxobutan-2-yl]sulfanyloxadiazol-3-ium-5-olate (PubChem CID 54730999) has the molecular formula C19H17N4O6S- and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-[1-[(4-nitrobenzene-6-id-1-yl)amino]-1-oxobutan-2-yl]sulfanyloxadiazol-3-ium-5-olate.
| Compound Name | 3-(4-methoxyphenyl)-4-[1-[(4-nitrobenzene-6-id-1-yl)amino]-1-oxobutan-2-yl]sulfanyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 54730999 |
| Molecular Formula | C19H17N4O6S- |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-[1-[(4-nitrobenzene-6-id-1-yl)amino]-1-oxobutan-2-yl]sulfanyloxadiazol-3-ium-5-olate |
| SMILES | CCC(Sc1c([O-])on[n+]1-c1ccc(OC)cc1)C(=O)Nc1[c-]cc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N4O6S/c1-3-16(17(24)20-12-4-6-14(7-5-12)23(26)27)30-18-19(25)29-21-22(18)13-8-10-15(28-2)11-9-13/h4,6-11,16,25H,3H2,1-2H3,(H,20,24)/p-1 |
| InChIKey | LHFPTQVGVBAOMN-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|