C11H11N3S2 — CID 5473103
1-amino-7,8,9,10-tetrahydroisothiochromeno[3,4-d]pyrimidine-6-thione (PubChem CID 5473103) has the molecular formula C11H11N3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-amino-7,8,9,10-tetrahydroisothiochromeno[3,4-d]pyrimidine-6-thione.
| Compound Name | 1-amino-7,8,9,10-tetrahydroisothiochromeno[3,4-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 5473103 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-amino-7,8,9,10-tetrahydroisothiochromeno[3,4-d]pyrimidine-6-thione |
| SMILES | Nc1ncnc2sc(=S)c3c(c12)CCCC3 |
| InChI | InChI=1S/C11H11N3S2/c12-9-8-6-3-1-2-4-7(6)11(15)16-10(8)14-5-13-9/h5H,1-4H2,(H2,12,13,14) |
| InChIKey | ZVGJZXCDYRWPOB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|