C25H16O10 — CID 54731641
6-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-4,5-dihydroxy-7-methoxychromen-2-one (PubChem CID 54731641) has the molecular formula C25H16O10 and a molecular weight of 476.39 g/mol. Its IUPAC name is 6-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-4,5-dihydroxy-7-methoxychromen-2-one.
| Compound Name | 6-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-4,5-dihydroxy-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 54731641 |
| Molecular Formula | C25H16O10 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 6-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-4,5-dihydroxy-7-methoxychromen-2-one |
| SMILES | COc1cc2oc(=O)cc(O)c2c(O)c1Oc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| InChI | InChI=1S/C25H16O10/c1-32-20-10-19-23(16(29)9-21(30)35-19)24(31)25(20)33-13-4-2-11(3-5-13)17-8-15(28)22-14(27)6-12(26)7-18(22)34-17/h2-10,26-27,29,31H,1H3 |
| InChIKey | LIOWMAULVGQGQT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|