C13H16O4 — CID 54734908
(5R)-3-acetyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-hydroxy-5-methylfuran-2-one (PubChem CID 54734908) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (5R)-3-acetyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-hydroxy-5-methylfuran-2-one.
| Compound Name | (5R)-3-acetyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-hydroxy-5-methylfuran-2-one |
|---|---|
| PubChem CID | 54734908 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5R)-3-acetyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-hydroxy-5-methylfuran-2-one |
| SMILES | CC/C=C/C=C/[C@@]1(C)OC(=O)C(C(C)=O)=C1O |
| InChI | InChI=1S/C13H16O4/c1-4-5-6-7-8-13(3)11(15)10(9(2)14)12(16)17-13/h5-8,15H,4H2,1-3H3/b6-5+,8-7+/t13-/m1/s1 |
| InChIKey | XCTBCLBVWJNOBK-YGIFUYDNSA-N |
| XLogP | 2.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|