C13H14O5S — CID 54735788
3-hydroxy-2-(1-hydroxy-2-phenylsulfanylethyl)-4-methoxy-2H-furan-5-one (PubChem CID 54735788) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-hydroxy-2-(1-hydroxy-2-phenylsulfanylethyl)-4-methoxy-2H-furan-5-one.
| Compound Name | 3-hydroxy-2-(1-hydroxy-2-phenylsulfanylethyl)-4-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 54735788 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-hydroxy-2-(1-hydroxy-2-phenylsulfanylethyl)-4-methoxy-2H-furan-5-one |
| SMILES | COC1=C(O)C(C(O)CSc2ccccc2)OC1=O |
| InChI | InChI=1S/C13H14O5S/c1-17-12-10(15)11(18-13(12)16)9(14)7-19-8-5-3-2-4-6-8/h2-6,9,11,14-15H,7H2,1H3 |
| InChIKey | IKEZZQQZTWZOAE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |