C18H15BrCl2N2O2 — CID 54737306
3-(4-bromobutyl)-1-(3,4-dichlorophenyl)-4-hydroxy-1,8-naphthyridin-2-one (PubChem CID 54737306) has the molecular formula C18H15BrCl2N2O2 and a molecular weight of 442.14 g/mol. Its IUPAC name is 3-(4-bromobutyl)-1-(3,4-dichlorophenyl)-4-hydroxy-1,8-naphthyridin-2-one.
| Compound Name | 3-(4-bromobutyl)-1-(3,4-dichlorophenyl)-4-hydroxy-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 54737306 |
| Molecular Formula | C18H15BrCl2N2O2 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 3-(4-bromobutyl)-1-(3,4-dichlorophenyl)-4-hydroxy-1,8-naphthyridin-2-one |
| SMILES | O=c1c(CCCCBr)c(O)c2cccnc2n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15BrCl2N2O2/c19-8-2-1-4-13-16(24)12-5-3-9-22-17(12)23(18(13)25)11-6-7-14(20)15(21)10-11/h3,5-7,9-10,24H,1-2,4,8H2 |
| InChIKey | FUNSXMWAMPBOMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|