C18H16ClN2O2S+ — CID 139671049
1-(3-chlorophenyl)-4-hydroxy-3-(thiolan-1-ium-1-yl)-1,8-naphthyridin-2-one (PubChem CID 139671049) has the molecular formula C18H16ClN2O2S+ and a molecular weight of 359.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-hydroxy-3-(thiolan-1-ium-1-yl)-1,8-naphthyridin-2-one.
| Compound Name | 1-(3-chlorophenyl)-4-hydroxy-3-(thiolan-1-ium-1-yl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139671049 |
| Molecular Formula | C18H16ClN2O2S+ |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-(3-chlorophenyl)-4-hydroxy-3-(thiolan-1-ium-1-yl)-1,8-naphthyridin-2-one |
| SMILES | O=c1c([S+]2CCCC2)c(O)c2cccnc2n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O2S/c19-12-5-3-6-13(11-12)21-17-14(7-4-8-20-17)15(22)16(18(21)23)24-9-1-2-10-24/h3-8,11H,1-2,9-10H2/p+1 |
| InChIKey | GPYJBPVKSHQSGQ-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|