C16H13ClN2O2S — CID 139671053
1-(3-chlorophenyl)-3-dimethylsulfonio-2-oxo-1,8-naphthyridin-4-olate (PubChem CID 139671053) has the molecular formula C16H13ClN2O2S and a molecular weight of 332.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-dimethylsulfonio-2-oxo-1,8-naphthyridin-4-olate.
| Compound Name | 1-(3-chlorophenyl)-3-dimethylsulfonio-2-oxo-1,8-naphthyridin-4-olate |
|---|---|
| PubChem CID | 139671053 |
| Molecular Formula | C16H13ClN2O2S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3-dimethylsulfonio-2-oxo-1,8-naphthyridin-4-olate |
| SMILES | C[S+](C)c1c([O-])c2cccnc2n(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C16H13ClN2O2S/c1-22(2)14-13(20)12-7-4-8-18-15(12)19(16(14)21)11-6-3-5-10(17)9-11/h3-9H,1-2H3 |
| InChIKey | MJSBDVABWCQFSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|