C19H13NO7 — CID 54740900
4-[2-(carboxymethylcarbamoyl)-1-hydroxy-3-oxoinden-4-yl]benzoic acid (PubChem CID 54740900) has the molecular formula C19H13NO7 and a molecular weight of 367.31 g/mol. Its IUPAC name is 4-[2-(carboxymethylcarbamoyl)-1-hydroxy-3-oxoinden-4-yl]benzoic acid.
| Compound Name | 4-[2-(carboxymethylcarbamoyl)-1-hydroxy-3-oxoinden-4-yl]benzoic acid |
|---|---|
| PubChem CID | 54740900 |
| Molecular Formula | C19H13NO7 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-[2-(carboxymethylcarbamoyl)-1-hydroxy-3-oxoinden-4-yl]benzoic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)c2cccc(-c3ccc(C(=O)O)cc3)c2C1=O |
| InChI | InChI=1S/C19H13NO7/c21-13(22)8-20-18(25)15-16(23)12-3-1-2-11(14(12)17(15)24)9-4-6-10(7-5-9)19(26)27/h1-7,23H,8H2,(H,20,25)(H,21,22)(H,26,27) |
| InChIKey | RRRCLTAZSIHYRP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|