C12H17NO9 — CID 54741801
ethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate (PubChem CID 54741801) has the molecular formula C12H17NO9 and a molecular weight of 319.27 g/mol. Its IUPAC name is ethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate.
| Compound Name | ethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 54741801 |
| Molecular Formula | C12H17NO9 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)OC1=C(O)C(C(O)CO)OC1=O |
| InChI | InChI=1S/C12H17NO9/c1-3-20-10(17)5(2)13-12(19)22-9-7(16)8(6(15)4-14)21-11(9)18/h5-6,8,14-16H,3-4H2,1-2H3,(H,13,19) |
| InChIKey | VQBXJOVGWKCQHT-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|