About 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine
1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine (PubChem CID 547523) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine.
Molecular Properties
| Compound Name | 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine |
| PubChem CID | 547523 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine |
| SMILES | C(=Nc1nccs1)c1ccncc1 |
| InChI | InChI=1S/C9H7N3S/c1-3-10-4-2-8(1)7-12-9-11-5-6-13-9/h1-7H |
| InChIKey | UFSGQCLHAAHWKA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine?
The IUPAC name of 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine (CID 547523) is 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine.
What is the SMILES notation for 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine?
The canonical SMILES for 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine is C(=Nc1nccs1)c1ccncc1.
What is the InChIKey of 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine?
The InChIKey is UFSGQCLHAAHWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c1-3-10-4-2-8(1)7-12-9-11-5-6-13-9/h1-7H.
What are the key properties of 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine?
1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine has a molecular weight of 189.24 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-4-yl-N-(1,3-thiazol-2-yl)methanimine is sourced from PubChem (CID 547523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).