C20H13N3O5 — CID 54753699
3-[(Z)-2-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(4-nitrophenyl)ethenyl]chromen-4-one (PubChem CID 54753699) has the molecular formula C20H13N3O5 and a molecular weight of 375.34 g/mol. Its IUPAC name is 3-[(Z)-2-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(4-nitrophenyl)ethenyl]chromen-4-one.
| Compound Name | 3-[(Z)-2-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(4-nitrophenyl)ethenyl]chromen-4-one |
|---|---|
| PubChem CID | 54753699 |
| Molecular Formula | C20H13N3O5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-[(Z)-2-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(4-nitrophenyl)ethenyl]chromen-4-one |
| SMILES | Cc1nc(/C(=C\c2coc3ccccc3c2=O)c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C20H13N3O5/c1-12-21-20(22-28-12)17(13-6-8-15(9-7-13)23(25)26)10-14-11-27-18-5-3-2-4-16(18)19(14)24/h2-11H,1H3/b17-10- |
| InChIKey | IAMDPFBSFICLJI-YVLHZVERSA-N |
| XLogP | 3.98 |
| TPSA | 112.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|