C26H34CuN2O2 — CID 5475599
copper;bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) (PubChem CID 5475599) has the molecular formula C26H34CuN2O2 and a molecular weight of 470.12 g/mol. Its IUPAC name is copper;bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one).
| Compound Name | copper;bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
|---|---|
| PubChem CID | 5475599 |
| Molecular Formula | C26H34CuN2O2 |
| Molecular Weight | 470.12 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | copper;bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| SMILES | O=C1C=CC=C/C1=C/NC1CCCCC1.O=C1C=CC=C/C1=C/NC1CCCCC1.[Cu] |
| InChI | InChI=1S/2C13H17NO.Cu/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*4-6,9-10,12,14H,1-3,7-8H2;/b2*11-10-; |
| InChIKey | GKXWPOJWVAEECT-DEZACRSWSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|