C22H26ClN3O2 — CID 54757900
tert-butyl N-[2-(6-chloro-2-methyl-4-phenyl-4H-quinazolin-3-yl)ethyl]carbamate (PubChem CID 54757900) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is tert-butyl N-[2-(6-chloro-2-methyl-4-phenyl-4H-quinazolin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-chloro-2-methyl-4-phenyl-4H-quinazolin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 54757900 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl N-[2-(6-chloro-2-methyl-4-phenyl-4H-quinazolin-3-yl)ethyl]carbamate |
| SMILES | CC1=Nc2ccc(Cl)cc2C(c2ccccc2)N1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26ClN3O2/c1-15-25-19-11-10-17(23)14-18(19)20(16-8-6-5-7-9-16)26(15)13-12-24-21(27)28-22(2,3)4/h5-11,14,20H,12-13H2,1-4H3,(H,24,27) |
| InChIKey | PUYHZXXYOZRDFL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |