C26H36N2O2 — CID 54759816
2-[1-(aminomethyl)cyclohexyl]-N-methyl-N-[3-(2-methylphenoxy)-3-phenylpropyl]acetamide (PubChem CID 54759816) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-methyl-N-[3-(2-methylphenoxy)-3-phenylpropyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-methyl-N-[3-(2-methylphenoxy)-3-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 54759816 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-methyl-N-[3-(2-methylphenoxy)-3-phenylpropyl]acetamide |
| SMILES | Cc1ccccc1OC(CCN(C)C(=O)CC1(CN)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O2/c1-21-11-7-8-14-23(21)30-24(22-12-5-3-6-13-22)15-18-28(2)25(29)19-26(20-27)16-9-4-10-17-26/h3,5-8,11-14,24H,4,9-10,15-20,27H2,1-2H3 |
| InChIKey | XWOBAOKXQZGGAC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |