C19H26NO4P — CID 58600354
N-dimethoxyphosphoryl-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine (PubChem CID 58600354) has the molecular formula C19H26NO4P and a molecular weight of 363.39 g/mol. Its IUPAC name is N-dimethoxyphosphoryl-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine.
| Compound Name | N-dimethoxyphosphoryl-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 58600354 |
| Molecular Formula | C19H26NO4P |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-dimethoxyphosphoryl-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine |
| SMILES | COP(=O)(OC)N(C)CCC(Oc1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C19H26NO4P/c1-16-10-8-9-13-18(16)24-19(17-11-6-5-7-12-17)14-15-20(2)25(21,22-3)23-4/h5-13,19H,14-15H2,1-4H3 |
| InChIKey | APAAEENTHIAAFF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|