C35H30ClN5O3 — CID 54760931
6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54760931) has the molecular formula C35H30ClN5O3 and a molecular weight of 604.11 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54760931 |
| Molecular Formula | C35H30ClN5O3 |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1(C)Oc2ccccc2C(=O)C1n1c(=O)c(-c2ccccc2Cl)cc2cnc(Nc3ccc(C4=CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C35H30ClN5O3/c1-35(2)31(30(42)26-8-4-6-10-29(26)44-35)41-32-23(19-27(33(41)43)25-7-3-5-9-28(25)36)20-38-34(40-32)39-24-13-11-21(12-14-24)22-15-17-37-18-16-22/h3-15,19-20,31,37H,16-18H2,1-2H3,(H,38,39,40) |
| InChIKey | FMVMWHXHTPDOLR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |