C21H19Cl2N5O — CID 5476286
(E)-1-chloro-4-[4-[[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]methylamino]phenyl]but-3-en-2-one (PubChem CID 5476286) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is (E)-1-chloro-4-[4-[[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]methylamino]phenyl]but-3-en-2-one.
| Compound Name | (E)-1-chloro-4-[4-[[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]methylamino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 5476286 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (E)-1-chloro-4-[4-[[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]methylamino]phenyl]but-3-en-2-one |
| SMILES | Nc1nc(N)c(-c2ccc(Cl)cc2)c(CNc2ccc(/C=C/C(=O)CCl)cc2)n1 |
| InChI | InChI=1S/C21H19Cl2N5O/c22-11-17(29)10-3-13-1-8-16(9-2-13)26-12-18-19(20(24)28-21(25)27-18)14-4-6-15(23)7-5-14/h1-10,26H,11-12H2,(H4,24,25,27,28)/b10-3+ |
| InChIKey | DLPUANAHXVGOAT-XCVCLJGOSA-N |
| XLogP | 4.39 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|