C25H26ClN3O3 — CID 54763442
5-[(6-chloro-3-pyridinyl)methyl]-8-[(1S,2S)-2-hydroxycyclohexyl]-9-(2-hydroxyethyl)-9H-pyrrolo[3,4-h]quinolin-7-one (PubChem CID 54763442) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methyl]-8-[(1S,2S)-2-hydroxycyclohexyl]-9-(2-hydroxyethyl)-9H-pyrrolo[3,4-h]quinolin-7-one.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methyl]-8-[(1S,2S)-2-hydroxycyclohexyl]-9-(2-hydroxyethyl)-9H-pyrrolo[3,4-h]quinolin-7-one |
|---|---|
| PubChem CID | 54763442 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methyl]-8-[(1S,2S)-2-hydroxycyclohexyl]-9-(2-hydroxyethyl)-9H-pyrrolo[3,4-h]quinolin-7-one |
| SMILES | O=C1c2cc(Cc3ccc(Cl)nc3)c3cccnc3c2C(CCO)N1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C25H26ClN3O3/c26-22-8-7-15(14-28-22)12-16-13-18-23(24-17(16)4-3-10-27-24)20(9-11-30)29(25(18)32)19-5-1-2-6-21(19)31/h3-4,7-8,10,13-14,19-21,30-31H,1-2,5-6,9,11-12H2/t19-,20?,21-/m0/s1 |
| InChIKey | HYQXWKILNSKOEZ-YSTUSHMSSA-N |
| XLogP | 4.06 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|