C20H21ClN2O2 — CID 118468365
6-[(6-chloro-3-pyridinyl)methyl]-2-(2-hydroxycyclohexyl)-3H-isoindol-1-one (PubChem CID 118468365) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-2-(2-hydroxycyclohexyl)-3H-isoindol-1-one.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(2-hydroxycyclohexyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 118468365 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(2-hydroxycyclohexyl)-3H-isoindol-1-one |
| SMILES | O=C1c2cc(Cc3ccc(Cl)nc3)ccc2CN1C1CCCCC1O |
| InChI | InChI=1S/C20H21ClN2O2/c21-19-8-6-14(11-22-19)9-13-5-7-15-12-23(20(25)16(15)10-13)17-3-1-2-4-18(17)24/h5-8,10-11,17-18,24H,1-4,9,12H2 |
| InChIKey | RABRTNUKGWZBKN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|