C25H26ClN3O — CID 91036375
2-[6-[(6-chloro-3-pyridinyl)methyl]-2-methyl-4H-benzo[h]quinazolin-3-yl]cyclohexan-1-ol (PubChem CID 91036375) has the molecular formula C25H26ClN3O and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-[6-[(6-chloro-3-pyridinyl)methyl]-2-methyl-4H-benzo[h]quinazolin-3-yl]cyclohexan-1-ol.
| Compound Name | 2-[6-[(6-chloro-3-pyridinyl)methyl]-2-methyl-4H-benzo[h]quinazolin-3-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 91036375 |
| Molecular Formula | C25H26ClN3O |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[6-[(6-chloro-3-pyridinyl)methyl]-2-methyl-4H-benzo[h]quinazolin-3-yl]cyclohexan-1-ol |
| SMILES | CC1=Nc2c(cc(Cc3ccc(Cl)nc3)c3ccccc23)CN1C1CCCCC1O |
| InChI | InChI=1S/C25H26ClN3O/c1-16-28-25-19(15-29(16)22-8-4-5-9-23(22)30)13-18(20-6-2-3-7-21(20)25)12-17-10-11-24(26)27-14-17/h2-3,6-7,10-11,13-14,22-23,30H,4-5,8-9,12,15H2,1H3 |
| InChIKey | RHDHOTARVRXOTM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|