C32H35BrN2O — CID 54767197
9-benzyl-2-hexyl-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide (PubChem CID 54767197) has the molecular formula C32H35BrN2O and a molecular weight of 543.55 g/mol. Its IUPAC name is 9-benzyl-2-hexyl-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 9-benzyl-2-hexyl-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 54767197 |
| Molecular Formula | C32H35BrN2O |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 9-benzyl-2-hexyl-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
| SMILES | CCCCCC[n+]1ccc2c3ccc(OCc4ccccc4)cc3n(Cc3ccccc3)c2c1C.[Br-] |
| InChI | InChI=1S/C32H35N2O.BrH/c1-3-4-5-12-20-33-21-19-30-29-18-17-28(35-24-27-15-10-7-11-16-27)22-31(29)34(32(30)25(33)2)23-26-13-8-6-9-14-26;/h6-11,13-19,21-22H,3-5,12,20,23-24H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KRSNLGJGHQIGRU-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|