C21H22FN3O8S — CID 54767315
2-(2-methyl-5-nitroimidazol-1-yl)ethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;sulfuric acid (PubChem CID 54767315) has the molecular formula C21H22FN3O8S and a molecular weight of 495.49 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;sulfuric acid.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;sulfuric acid |
|---|---|
| PubChem CID | 54767315 |
| Molecular Formula | C21H22FN3O8S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;sulfuric acid |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)[C@@H](C)c1ccc(-c2ccccc2)c(F)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C21H20FN3O4.H2O4S/c1-14(17-8-9-18(19(22)12-17)16-6-4-3-5-7-16)21(26)29-11-10-24-15(2)23-13-20(24)25(27)28;1-5(2,3)4/h3-9,12-14H,10-11H2,1-2H3;(H2,1,2,3,4)/t14-;/m0./s1 |
| InChIKey | CSQHDUPIAMKBNM-UQKRIMTDSA-N |
| XLogP | 3.60 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|