C21H20O5 — CID 54768999
(3E)-3-[1-(2-methyl-5-prop-2-enoxy-1-benzofuran-3-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione (PubChem CID 54768999) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3E)-3-[1-(2-methyl-5-prop-2-enoxy-1-benzofuran-3-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione.
| Compound Name | (3E)-3-[1-(2-methyl-5-prop-2-enoxy-1-benzofuran-3-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione |
|---|---|
| PubChem CID | 54768999 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3E)-3-[1-(2-methyl-5-prop-2-enoxy-1-benzofuran-3-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione |
| SMILES | C=CCOc1ccc2oc(C)c(/C(C)=C3/C(=O)OC(=O)C3=C(C)C)c2c1 |
| InChI | InChI=1S/C21H20O5/c1-6-9-24-14-7-8-16-15(10-14)18(13(5)25-16)12(4)19-17(11(2)3)20(22)26-21(19)23/h6-8,10H,1,9H2,2-5H3/b19-12+ |
| InChIKey | JGOXOUFIHIIJIW-XDHOZWIPSA-N |
| XLogP | 4.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|