C20H24O8 — CID 5477758
[(10E)-10-(hydroxymethyl)-4-methyl-15-methylidene-14-oxo-5,8,13-trioxatetracyclo[10.3.0.04,6.07,9]pentadec-10-en-2-yl] (E)-2-(hydroxymethyl)but-2-enoate (PubChem CID 5477758) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is [(10E)-10-(hydroxymethyl)-4-methyl-15-methylidene-14-oxo-5,8,13-trioxatetracyclo[10.3.0.04,6.07,9]pentadec-10-en-2-yl] (E)-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [(10E)-10-(hydroxymethyl)-4-methyl-15-methylidene-14-oxo-5,8,13-trioxatetracyclo[10.3.0.04,6.07,9]pentadec-10-en-2-yl] (E)-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 5477758 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(10E)-10-(hydroxymethyl)-4-methyl-15-methylidene-14-oxo-5,8,13-trioxatetracyclo[10.3.0.04,6.07,9]pentadec-10-en-2-yl] (E)-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2/C=C(\CO)C3OC3C3OC3(C)CC(OC(=O)/C(=C/C)CO)C12 |
| InChI | InChI=1S/C20H24O8/c1-4-10(7-21)19(24)26-13-6-20(3)17(28-20)16-15(27-16)11(8-22)5-12-14(13)9(2)18(23)25-12/h4-5,12-17,21-22H,2,6-8H2,1,3H3/b10-4+,11-5+ |
| InChIKey | TZMBEJAHWVHDNJ-ZVSIBQGLSA-N |
| XLogP | 0.18 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|