C11H11N5O2S2 — CID 5480533
6-methyl-N-[(Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]imidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 5480533) has the molecular formula C11H11N5O2S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 6-methyl-N-[(Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]imidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 6-methyl-N-[(Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 5480533 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-methyl-N-[(Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2sccn2c1C(=O)N/N=C1\SCC(=O)N1C |
| InChI | InChI=1S/C11H11N5O2S2/c1-6-8(16-3-4-19-10(16)12-6)9(18)13-14-11-15(2)7(17)5-20-11/h3-4H,5H2,1-2H3,(H,13,18)/b14-11- |
| InChIKey | HNKRQBARRWSIPV-KAMYIIQDSA-N |
| XLogP | 0.91 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|