C15H25ClN2 — CID 54806314
N'-(4-chlorophenyl)-N-heptylethane-1,2-diamine (PubChem CID 54806314) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-heptylethane-1,2-diamine.
| Compound Name | N'-(4-chlorophenyl)-N-heptylethane-1,2-diamine |
|---|---|
| PubChem CID | 54806314 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N'-(4-chlorophenyl)-N-heptylethane-1,2-diamine |
| SMILES | CCCCCCCNCCNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H25ClN2/c1-2-3-4-5-6-11-17-12-13-18-15-9-7-14(16)8-10-15/h7-10,17-18H,2-6,11-13H2,1H3 |
| InChIKey | VAILRGQPULLZPK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|