C7H14OS — CID 548225
2,5,6-trimethyl-1,3-oxathiane (PubChem CID 548225) has the molecular formula C7H14OS and a molecular weight of 146.25 g/mol. Its IUPAC name is 2,5,6-trimethyl-1,3-oxathiane.
| Compound Name | 2,5,6-trimethyl-1,3-oxathiane |
|---|---|
| PubChem CID | 548225 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,5,6-trimethyl-1,3-oxathiane |
| SMILES | CC1OC(C)C(C)CS1 |
| InChI | InChI=1S/C7H14OS/c1-5-4-9-7(3)8-6(5)2/h5-7H,4H2,1-3H3 |
| InChIKey | QVEVMFNTJKZPNQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |