C25H28N2O2 — CID 54823876
2-[4-(2-phenylethoxy)anilino]-N-(1-phenylpropyl)acetamide (PubChem CID 54823876) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[4-(2-phenylethoxy)anilino]-N-(1-phenylpropyl)acetamide.
| Compound Name | 2-[4-(2-phenylethoxy)anilino]-N-(1-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 54823876 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[4-(2-phenylethoxy)anilino]-N-(1-phenylpropyl)acetamide |
| SMILES | CCC(NC(=O)CNc1ccc(OCCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-2-24(21-11-7-4-8-12-21)27-25(28)19-26-22-13-15-23(16-14-22)29-18-17-20-9-5-3-6-10-20/h3-16,24,26H,2,17-19H2,1H3,(H,27,28) |
| InChIKey | AOVNUEJUBKYMFV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|