C9H12N4O — CID 54853977
2-amino-6-cyclopropyl-N-methylpyrimidine-4-carboxamide (PubChem CID 54853977) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-amino-6-cyclopropyl-N-methylpyrimidine-4-carboxamide.
| Compound Name | 2-amino-6-cyclopropyl-N-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 54853977 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-amino-6-cyclopropyl-N-methylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1cc(C2CC2)nc(N)n1 |
| InChI | InChI=1S/C9H12N4O/c1-11-8(14)7-4-6(5-2-3-5)12-9(10)13-7/h4-5H,2-3H2,1H3,(H,11,14)(H2,10,12,13) |
| InChIKey | MERSVFJESLGCRU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |