C13H18ClNO3S — CID 54877239
1-(3-chloropropylsulfonyl)-8-methoxy-3,4-dihydro-2H-quinoline (PubChem CID 54877239) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 1-(3-chloropropylsulfonyl)-8-methoxy-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3-chloropropylsulfonyl)-8-methoxy-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 54877239 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(3-chloropropylsulfonyl)-8-methoxy-3,4-dihydro-2H-quinoline |
| SMILES | COc1cccc2c1N(S(=O)(=O)CCCCl)CCC2 |
| InChI | InChI=1S/C13H18ClNO3S/c1-18-12-7-2-5-11-6-3-9-15(13(11)12)19(16,17)10-4-8-14/h2,5,7H,3-4,6,8-10H2,1H3 |
| InChIKey | LTNWPVQQKKVDSM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|