About 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid
2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid (PubChem CID 61457991) has the molecular formula C13H17NO5S
and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid.
Molecular Properties
| Compound Name | 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid |
| PubChem CID | 61457991 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid |
| SMILES | COc1cccc2c1N(S(=O)(=O)C(C)C(=O)O)CCC2 |
| InChI | InChI=1S/C13H17NO5S/c1-9(13(15)16)20(17,18)14-8-4-6-10-5-3-7-11(19-2)12(10)14/h3,5,7,9H,4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | YKYZZRTUOSTIFV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid?
The IUPAC name of 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid (CID 61457991) is 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid.
What is the SMILES notation for 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid?
The canonical SMILES for 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid is COc1cccc2c1N(S(=O)(=O)C(C)C(=O)O)CCC2.
What is the InChIKey of 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid?
The InChIKey is YKYZZRTUOSTIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5S/c1-9(13(15)16)20(17,18)14-8-4-6-10-5-3-7-11(19-2)12(10)14/h3,5,7,9H,4,6,8H2,1-2H3,(H,15,16).
What are the key properties of 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid?
2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid has a molecular weight of 299.35 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]propanoic acid is sourced from PubChem (CID 61457991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).