2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid

C14H21NO3 — CID 54901724

IUPAC2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid
SMILESC/C=C/C=C/C(=O)NC(C(=O)O)C1CCCCC1
InChIInChI=1S/C14H21NO3/c1-2-3-5-10-12(16)15-13(14(17)18)11-8-6-4-7-9-11/h2-3,5,10-11,13H,4,6-9H2,1H3,(H,15,16)(H,17,18)/b3-2+,10-5+
InChIKeyDONDMHIILNVSJH-XPQLPGEHSA-N
MW251.33 g/mol
LogP2.27
Rot. Bonds5

About 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid

2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid (PubChem CID 54901724) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid.

Molecular Properties

Compound Name2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid
PubChem CID54901724
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Name2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid
SMILESC/C=C/C=C/C(=O)NC(C(=O)O)C1CCCCC1
InChIInChI=1S/C14H21NO3/c1-2-3-5-10-12(16)15-13(14(17)18)11-8-6-4-7-9-11/h2-3,5,10-11,13H,4,6-9H2,1H3,(H,15,16)(H,17,18)/b3-2+,10-5+
InChIKeyDONDMHIILNVSJH-XPQLPGEHSA-N
XLogP2.27
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid?
The IUPAC name of 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid (CID 54901724) is 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid.
What is the SMILES notation for 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid?
The canonical SMILES for 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid is C/C=C/C=C/C(=O)NC(C(=O)O)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid?
The InChIKey is DONDMHIILNVSJH-XPQLPGEHSA-N. The full InChI is InChI=1S/C14H21NO3/c1-2-3-5-10-12(16)15-13(14(17)18)11-8-6-4-7-9-11/h2-3,5,10-11,13H,4,6-9H2,1H3,(H,15,16)(H,17,18)/b3-2+,10-5+.
What are the key properties of 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid?
2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid has a molecular weight of 251.33 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]acetic acid is sourced from PubChem (CID 54901724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).