About 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide
4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide (PubChem CID 54914234) has the molecular formula C11H20N2O4S
and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide |
| PubChem CID | 54914234 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(NC2CS(=O)(=O)CC2O)CC1 |
| InChI | InChI=1S/C11H20N2O4S/c12-11(15)7-1-3-8(4-2-7)13-9-5-18(16,17)6-10(9)14/h7-10,13-14H,1-6H2,(H2,12,15) |
| InChIKey | MKZRBEYINGLYOA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide?
The IUPAC name of 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide (CID 54914234) is 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide?
The canonical SMILES for 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide is NC(=O)C1CCC(NC2CS(=O)(=O)CC2O)CC1.
What is the InChIKey of 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide?
The InChIKey is MKZRBEYINGLYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4S/c12-11(15)7-1-3-8(4-2-7)13-9-5-18(16,17)6-10(9)14/h7-10,13-14H,1-6H2,(H2,12,15).
What are the key properties of 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide?
4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide has a molecular weight of 276.36 g/mol, XLogP of -1.22, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]cyclohexane-1-carboxamide is sourced from PubChem (CID 54914234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).