C14H12FN3 — CID 54919596
(6-fluoro-1H-benzimidazol-2-yl)-phenylmethanamine (PubChem CID 54919596) has the molecular formula C14H12FN3 and a molecular weight of 241.27 g/mol. Its IUPAC name is (6-fluoro-1H-benzimidazol-2-yl)-phenylmethanamine.
| Compound Name | (6-fluoro-1H-benzimidazol-2-yl)-phenylmethanamine |
|---|---|
| PubChem CID | 54919596 |
| Molecular Formula | C14H12FN3 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (6-fluoro-1H-benzimidazol-2-yl)-phenylmethanamine |
| SMILES | NC(c1ccccc1)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C14H12FN3/c15-10-6-7-11-12(8-10)18-14(17-11)13(16)9-4-2-1-3-5-9/h1-8,13H,16H2,(H,17,18) |
| InChIKey | AKEAQRGEKKFDBP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |