C16H29NO2 — CID 54938609
1-(1-cyclopropylethylamino)-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propan-2-ol (PubChem CID 54938609) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-(1-cyclopropylethylamino)-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propan-2-ol.
| Compound Name | 1-(1-cyclopropylethylamino)-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 54938609 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 1-(1-cyclopropylethylamino)-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propan-2-ol |
| SMILES | CC1CC=CCC1COCC(O)CNC(C)C1CC1 |
| InChI | InChI=1S/C16H29NO2/c1-12-5-3-4-6-15(12)10-19-11-16(18)9-17-13(2)14-7-8-14/h3-4,12-18H,5-11H2,1-2H3 |
| InChIKey | FWXXSHXSOBLDPI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|