C8H12BrN3O3S2 — CID 54952549
2-[(3-bromothiophen-2-yl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 54952549) has the molecular formula C8H12BrN3O3S2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 54952549 |
| Molecular Formula | C8H12BrN3O3S2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(C)(NS(=O)(=O)c1sccc1Br)C(N)=NO |
| InChI | InChI=1S/C8H12BrN3O3S2/c1-8(2,7(10)11-13)12-17(14,15)6-5(9)3-4-16-6/h3-4,12-13H,1-2H3,(H2,10,11) |
| InChIKey | HODWQCNVGNREGW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|