C18H22BrNO3 — CID 5499204
[(2S)-butan-2-yl] (1S,6S)-6-[(3-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 5499204) has the molecular formula C18H22BrNO3 and a molecular weight of 380.28 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (1S,6S)-6-[(3-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (1S,6S)-6-[(3-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 5499204 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [(2S)-butan-2-yl] (1S,6S)-6-[(3-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC[C@H](C)OC(=O)[C@H]1CC=CC[C@@H]1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H22BrNO3/c1-3-12(2)23-18(22)16-10-5-4-9-15(16)17(21)20-14-8-6-7-13(19)11-14/h4-8,11-12,15-16H,3,9-10H2,1-2H3,(H,20,21)/t12-,15-,16-/m0/s1 |
| InChIKey | VGNAYAJWCDCBSH-RCBQFDQVSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|