C17H17Br2NO3 — CID 28694702
prop-2-enyl (1R,6R)-6-[(3,5-dibromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 28694702) has the molecular formula C17H17Br2NO3 and a molecular weight of 443.14 g/mol. Its IUPAC name is prop-2-enyl (1R,6R)-6-[(3,5-dibromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | prop-2-enyl (1R,6R)-6-[(3,5-dibromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 28694702 |
| Molecular Formula | C17H17Br2NO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | prop-2-enyl (1R,6R)-6-[(3,5-dibromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1CC=CC[C@H]1C(=O)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H17Br2NO3/c1-2-7-23-17(22)15-6-4-3-5-14(15)16(21)20-13-9-11(18)8-12(19)10-13/h2-4,8-10,14-15H,1,5-7H2,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | LCTPATMWFWBYGR-HUUCEWRRSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|