C19H22BrNO4 — CID 124757179
[(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 124757179) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 124757179 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-bromophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OC[C@H]1CCCO1)[C@H]1CC=CC[C@H]1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H22BrNO4/c20-13-7-9-14(10-8-13)21-18(22)16-5-1-2-6-17(16)19(23)25-12-15-4-3-11-24-15/h1-2,7-10,15-17H,3-6,11-12H2,(H,21,22)/t15-,16-,17+/m1/s1 |
| InChIKey | VWJCKJXYRBQCHE-ZACQAIPSSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|