C19H23NO4 — CID 727111
[(2S)-oxolan-2-yl]methyl (1R,6R)-6-(phenylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 727111) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (1R,6R)-6-(phenylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (1R,6R)-6-(phenylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 727111 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (1R,6R)-6-(phenylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CC=CC[C@H]1C(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H23NO4/c21-18(20-14-7-2-1-3-8-14)16-10-4-5-11-17(16)19(22)24-13-15-9-6-12-23-15/h1-5,7-8,15-17H,6,9-13H2,(H,20,21)/t15-,16+,17+/m0/s1 |
| InChIKey | CZCCSGOHGQOHTD-GVDBMIGSSA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|