C20H25NO4 — CID 6919534
[(2S)-oxolan-2-yl]methyl (1S,6R)-6-[(4-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6919534) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (1S,6R)-6-[(4-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (1S,6R)-6-[(4-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6919534 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (1S,6R)-6-[(4-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-14-8-10-15(11-9-14)21-19(22)17-6-2-3-7-18(17)20(23)25-13-16-5-4-12-24-16/h2-3,8-11,16-18H,4-7,12-13H2,1H3,(H,21,22)/t16-,17+,18-/m0/s1 |
| InChIKey | ZYAUEGBUOVBDRH-KSZLIROESA-N |
| XLogP | 3.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|