C21H25NO5 — CID 42560871
[(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-acetylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 42560871) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-acetylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-acetylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 42560871 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (1S,6R)-6-[(4-acetylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-14(23)15-8-10-16(11-9-15)22-20(24)18-6-2-3-7-19(18)21(25)27-13-17-5-4-12-26-17/h2-3,8-11,17-19H,4-7,12-13H2,1H3,(H,22,24)/t17-,18-,19+/m1/s1 |
| InChIKey | NOCTYDBFKZROLD-QRVBRYPASA-N |
| XLogP | 3.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|