C14H18N4O — CID 54998527
3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-propan-2-ylamino]propanenitrile (PubChem CID 54998527) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-propan-2-ylamino]propanenitrile.
| Compound Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 54998527 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)c1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H18N4O/c1-9(2)18(5-3-4-15)13-8-12-10(6-11(13)16)7-14(19)17-12/h6,8-9H,3,5,7,16H2,1-2H3,(H,17,19) |
| InChIKey | DHCCDGXGNARULP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|