C12H18F6O2 — CID 550138
4-ethyl-5-pentyl-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 550138) has the molecular formula C12H18F6O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 4-ethyl-5-pentyl-2,2-bis(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4-ethyl-5-pentyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 550138 |
| Molecular Formula | C12H18F6O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-ethyl-5-pentyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | CCCCCC1OC(C(F)(F)F)(C(F)(F)F)OC1CC |
| InChI | InChI=1S/C12H18F6O2/c1-3-5-6-7-9-8(4-2)19-10(20-9,11(13,14)15)12(16,17)18/h8-9H,3-7H2,1-2H3 |
| InChIKey | SYCHQSRRNGBAJJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|